Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0308 |
| Product Name | 2,4-Diaminophenoxyethanol Sulfate |
| CAS | 70643-20-8 |
| Structure |  |
| Synonyms | 2-(2,4-Diaminophenoxy)ethanol sulfate |
| IUPAC Name | 2-(2,4-diaminophenoxy)ethanol;sulfuric acid |
| Molecular Weight | 266.27 g/mol |
| Molecular Formula | C8H14N2O6S |
| InChI | InChI=1S/C8H12N2O2.H2O4S/c9-6-1-2-8(7(10)5-6)12-4-3-11;1-5(2,3)4/h1-2,5,11H,3-4,9-10H2;(H2,1,2,3,4) |
| InChI Key | UUHBEKCQQLDQNG-UHFFFAOYSA-N |
| Purity | 0.98 |
| Density | 1.51 g/mL |
| Isomeric SMILES | C1=CC(=C(C=C1N)N)OCCO.OS(=O)(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
