Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0302 |
| Product Name | 2,4-Diaminophenoxyethanol HCl |
| CAS | 66422-95-5 |
| Structure |  |
| Synonyms | 2-(2,4-Diaminophenoxy)ethanol dihydrochloride |
| IUPAC Name | 2-(2,4-diaminophenoxy)ethanol;dihydrochloride |
| Molecular Weight | 204.65 g/mol |
| Molecular Formula | C8H13ClN2O2 |
| InChI | InChI=1S/C8H12N2O2.2ClH/c9-6-1-2-8(7(10)5-6)12-4-3-11;;/h1-2,5,11H,3-4,9-10H2;2*1H |
| InChI Key | VXYWXJXCQSDNHX-UHFFFAOYSA-N |
| Melting Point | 222-224 °C |
| Purity | 0.96 |
| Density | 1.41 g/mL |
| Appearance | Pale grey solid |
| Isomeric SMILES | C1=CC(=C(C=C1N)N)OCCO.Cl.Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
