Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0126 |
| Product Name | 7-Dehydrocholesterol |
| CAS | 434-16-2 |
| Structure |  |
| Synonyms | 7,8-Didehydrocholesterol;Cholesta-5,7-dien-3-beta-ol |
| IUPAC Name | (3S,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Molecular Weight | 384.64 g/mol |
| Molecular Formula | C27H44O |
| InChI | InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9-10,18-19,21,23-25,28H,6-8,11-17H2,1-5H3/t19-,21+,23-,24+,25+,26+,27-/m1/s1 |
| InChI Key | UCTLRSWJYQTBFZ-DDPQNLDTSA-N |
| Boiling Point | 451.27 °C |
| Melting Point | 148-152 °C |
| Purity | 95% |
| Density | 0.97 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.005 |
| Highest Usage In Rinsing Products | 0.01 |
| Isomeric SMILES | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC=C4[C@@]3(CC[C@@H](C4)O)C)C |
| pKa | 14.91±0.70 |
If you have any questions, please contact us. You will get a satisfactory answer.
