Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0022 |
| Product Name | Dedm Hydantoin |
| CAS | 26850-24-8 |
| Structure |  |
| Synonyms | 1,3-Bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione |
| IUPAC Name | 1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione |
| Molecular Weight | 216.23 g/mol |
| Molecular Formula | C9H16N2O4 |
| InChI | InChI=1S/C9H16N2O4/c1-9(2)7(14)10(3-5-12)8(15)11(9)4-6-13/h12-13H,3-6H2,1-2H3 |
| InChI Key | ATIAIEWDRRJGSL-UHFFFAOYSA-N |
| Boiling Point | 355.8±52.0 °C |
| Purity | 95% |
| Density | 1.254 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1(C(=O)N(C(=O)N1CCO)CCO)C |
| pKa | 14.49±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
