Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0095 |
| Product Name | Cysteine HCl |
| CAS | 52-89-1 |
| Structure |  |
| Synonyms | Cysteine HCl;Cysteine hydrochloride;L-Cysteine, hydrochloride |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;hydrochloride |
| Molecular Weight | 157.62 g/mol |
| Molecular Formula | C3H8ClNO2S |
| InChI | InChI=1S/C3H7NO2S.ClH/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H/t2-;/m0./s1 |
| InChI Key | IFQSXNOEEPCSLW-DKWTVANSSA-N |
| Melting Point | 180 °C |
| Purity | 95% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.001 |
| Highest Usage In Rinsing Products | 0.11 |
| Isomeric SMILES | C([C@@H](C(=O)O)N)S.Cl |
What is the chemical name of the compound referred to as L-Cysteine monohydrochloride?
The chemical name is L-(+)-α-amino-β-thiopropionic acid.
What is the molecular formula for L-Cysteine monohydrochloride?
The molecular formula is C3H8ClNO2S.
What is the melting point of L-Cysteine monohydrochloride?
The melting point is 180°C.
How soluble is L-Cysteine monohydrochloride in water?
It is soluble in water with 1 M at 20 °C.
What is the color of L-Cysteine monohydrochloride?
It is white to light brown in color.
What is the hazard code associated with L-Cysteine monohydrochloride?
The hazard code is Xi.
What is the primary usage of L-Cysteine hydrochloride, anhydrous?
It is used as an additive in food production, as an antioxidant, and in cosmetics and animal feed.
What safety precautions should be taken when handling L-Cysteine monohydrochloride?
It is sensitive to light, moisture, and air, and incompatible with strong oxidizing agents. Precautions include using an inert atmosphere and storing at room temperature.
What is the toxicological profile of L-Cysteine monohydrochloride?
The LD50 intraperitoneal in mouse is 1250mg/kg, indicating moderate toxicity.
What is the General Description of L-Cysteine?
L-cysteine is described as a sulfur-containing amino acid.
If you have any questions, please contact us. You will get a satisfactory answer.
