Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0248 |
| Product Name | Cyclotrisiloxane |
| CAS | 541-05-9 |
| Structure |  |
| Synonyms | Hexamethylcyclotrisiloxane;Cyclotrisiloxane |
| IUPAC Name | 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane |
| Molecular Weight | 222.46 g/mol |
| Molecular Formula | C6H18O3Si3 |
| InChI | InChI=1S/C6H18O3Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h1-6H3 |
| InChI Key | HTDJPCNNEPUOOQ-UHFFFAOYSA-N |
| Boiling Point | 134 °C |
| Melting Point | 50-64 °C |
| Purity | 95% |
| Density | 1.02 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C[Si]1(O[Si](O[Si](O1)(C)C)(C)C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
