Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1321 |
| Product Name | Cupric Acetate |
| CAS | 142-71-2 |
| Structure |  |
| Synonyms | Copper(II) acetate |
| IUPAC Name | copper;diacetate |
| Molecular Weight | 181.63 g/mol |
| Molecular Formula | C4H6CuO4 |
| InChI | InChI=1S/2C2H4O2.Cu/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChI Key | OPQARKPSCNTWTJ-UHFFFAOYSA-L |
| Melting Point | 115 °C |
| Purity | 95% |
| Density | 1.92 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC(=O)[O-].CC(=O)[O-].[Cu+2] |
If you have any questions, please contact us. You will get a satisfactory answer.
