Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-BP-0009 |
Product Name | Cosmetic Peptide Palmitoyl Tripeptide-8 |
CAS | 936544-53-5 |
Synonyms | Palmitoyl tripeptide-8 |
IUPAC Name | N-[(2S)-1-[[(2R)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]hexadecanamide |
Molecular Weight | 695.94 g/mol |
Molecular Formula | C37H61N9O4 |
InChI | InChI=1S/C37H61N9O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-22-33(47)44-32(25-29-26-41-27-43-29)36(50)46-31(24-28-19-15-14-16-20-28)35(49)45-30(34(38)48)21-18-23-42-37(39)40/h14-16,19-20,26-27,30-32H,2-13,17-18,21-25H2,1H3,(H2,38,48)(H,41,43)(H,44,47)(H,45,49)(H,46,50)(H4,39,40,42)/t30-,31+,32-/m0/s1 |
InChI Key | WBHUVOTYPRYBNG-QAXCHELISA-N |
Purity | 0.95 |
Density | 1.2 g/mL |
Appearance | Solid |
Isomeric SMILES | CCCCCCCCCCCCCCCC(=O)N[C@@H](CC1=CN=CN1)C(=O)N[C@H](CC2=CC=CC=C2)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
What is the chemical formula for Palmitoyl Tripeptide-8?
The chemical formula for Palmitoyl Tripeptide-8 is C37H61N9O4.
What is the CAS number for Palmitoyl Tripeptide-8?
The CAS number for Palmitoyl Tripeptide-8 is 936544-53-5.
What are some synonyms for Palmitoyl Tripeptide-8?
Some synonyms for Palmitoyl Tripeptide-8 include Neutrazen, Palmiltoyl Tripeptide-8, Pal-His-D-Phe-Arg-NH2, and PALMITOYL TETRAPEPTIDE-8.
What is the predicted density of Palmitoyl Tripeptide-8?
The predicted density of Palmitoyl Tripeptide-8 is 1.20±0.1 g/cm3.
What is the predicted pKa value of Palmitoyl Tripeptide-8?
The predicted pKa value of Palmitoyl Tripeptide-8 is 13.34±0.46.
What is the InChIKey for Palmitoyl Tripeptide-8?
The InChIKey for Palmitoyl Tripeptide-8 is WBHUVOTYPRYBNG-QAXCHELISA-N.
What are some of the benefits of using Palmitoyl Tripeptide-8?
Some benefits of using Palmitoyl Tripeptide-8 include high affinity with MC1-R, specific anti-inflammatory activity, and effectively inhibiting IL-8 release induced by UVB.
What is the recommended dosage for Palmitoyl Tripeptide-8?
The recommended dosage for Palmitoyl Tripeptide-8 is 0.3~2.5%.
How does Palmitoyl Tripeptide-8 maintain and restore a normal skin sensitivity threshold?
Palmitoyl Tripeptide-8 maintains and restores a normal skin sensitivity threshold by inhibiting IL-8 release induced by UVB.
What is the molecular weight of Palmitoyl Tripeptide-8?
The molecular weight of Palmitoyl Tripeptide-8 is 695.94.