Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Cosmetic Peptide Palmitoyl Tripeptide-8

Online Inquiry
Catalog Number CI-BP-0009
Product Name Cosmetic Peptide Palmitoyl Tripeptide-8
CAS 936544-53-5
Synonyms Palmitoyl tripeptide-8
IUPAC Name N-[(2S)-1-[[(2R)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]hexadecanamide
Molecular Weight 695.94 g/mol
Molecular Formula C37H61N9O4
InChI InChI=1S/C37H61N9O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-22-33(47)44-32(25-29-26-41-27-43-29)36(50)46-31(24-28-19-15-14-16-20-28)35(49)45-30(34(38)48)21-18-23-42-37(39)40/h14-16,19-20,26-27,30-32H,2-13,17-18,21-25H2,1H3,(H2,38,48)(H,41,43)(H,44,47)(H,45,49)(H,46,50)(H4,39,40,42)/t30-,31+,32-/m0/s1
InChI Key WBHUVOTYPRYBNG-QAXCHELISA-N
Purity 0.95
Density 1.2 g/mL
Appearance Solid
Isomeric SMILES CCCCCCCCCCCCCCCC(=O)N[C@@H](CC1=CN=CN1)C(=O)N[C@H](CC2=CC=CC=C2)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N
Custom Q&A

What is the chemical formula for Palmitoyl Tripeptide-8?

The chemical formula for Palmitoyl Tripeptide-8 is C37H61N9O4.

What is the CAS number for Palmitoyl Tripeptide-8?

The CAS number for Palmitoyl Tripeptide-8 is 936544-53-5.

What are some synonyms for Palmitoyl Tripeptide-8?

Some synonyms for Palmitoyl Tripeptide-8 include Neutrazen, Palmiltoyl Tripeptide-8, Pal-His-D-Phe-Arg-NH2, and PALMITOYL TETRAPEPTIDE-8.

What is the predicted density of Palmitoyl Tripeptide-8?

The predicted density of Palmitoyl Tripeptide-8 is 1.20±0.1 g/cm3.

What is the predicted pKa value of Palmitoyl Tripeptide-8?

The predicted pKa value of Palmitoyl Tripeptide-8 is 13.34±0.46.

What is the InChIKey for Palmitoyl Tripeptide-8?

The InChIKey for Palmitoyl Tripeptide-8 is WBHUVOTYPRYBNG-QAXCHELISA-N.

What are some of the benefits of using Palmitoyl Tripeptide-8?

Some benefits of using Palmitoyl Tripeptide-8 include high affinity with MC1-R, specific anti-inflammatory activity, and effectively inhibiting IL-8 release induced by UVB.

What is the recommended dosage for Palmitoyl Tripeptide-8?

The recommended dosage for Palmitoyl Tripeptide-8 is 0.3~2.5%.

How does Palmitoyl Tripeptide-8 maintain and restore a normal skin sensitivity threshold?

Palmitoyl Tripeptide-8 maintains and restores a normal skin sensitivity threshold by inhibiting IL-8 release induced by UVB.

What is the molecular weight of Palmitoyl Tripeptide-8?

The molecular weight of Palmitoyl Tripeptide-8 is 695.94.

Online Inquiry
Verification code