Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0085 |
| Product Name | Cosmetic peptide acetyl tetrapeptide-9 |
| CAS | 928006-50-2 |
| Structure |  |
| Synonyms | Acetyl tetrapeptide-9 |
| IUPAC Name | (3S)-3-[[(2S)-2-acetamido-5-amino-5-oxopentanoyl]amino]-4-[[(2S)-1-[[(1S)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| Molecular Weight | 539.54 g/mol |
| Molecular Formula | C22H33N7O9 |
| InChI | InChI=1S/C22H33N7O9/c1-10(2)18(21(36)28-15(22(37)38)6-12-8-24-9-25-12)29-20(35)14(7-17(32)33)27-19(34)13(26-11(3)30)4-5-16(23)31/h8-10,13-15,18H,4-7H2,1-3H3,(H2,23,31)(H,24,25)(H,26,30)(H,27,34)(H,28,36)(H,29,35)(H,32,33)(H,37,38)/t13-,14-,15-,18-/m0/s1 |
| InChI Key | QNZANUZIBYJBIN-XSWJXKHESA-N |
| Boiling Point | 1169.0±65.0 °C |
| Density | 1.383 g/mL |
| Storage | 2-8 °C |
| Isomeric SMILES | CC(C)[C@@H](C(=O)N[C@@H](CC1=CN=CN1)C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)N)NC(=O)C |
| pKa | 2.84±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
