Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0031 |
| Product Name | Cloflucarban |
| CAS | 369-77-7 |
| Structure |  |
| Synonyms | 4,4'-Dichlro-3-(trifluoromethyl)carbanilide |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| Molecular Weight | 349.14 g/mol |
| Molecular Formula | C14H9Cl2F3N2O |
| InChI | InChI=1S/C14H9Cl2F3N2O/c15-8-1-3-9(4-2-8)20-13(22)21-10-5-6-12(16)11(7-10)14(17,18)19/h1-7H,(H2,20,21,22) |
| InChI Key | ZFSXZJXLKAJIGS-UHFFFAOYSA-N |
| Boiling Point | 328.8±42.0 °C |
| Melting Point | 214 °C |
| Purity | 0.98 |
| Density | 1.536 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=CC=C1NC(=O)NC2=CC(=C(C=C2)Cl)C(F)(F)F)Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
