Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1288 |
| Product Name | Citrulline |
| CAS | 372-75-8 |
| Structure |  |
| Synonyms | L-Citrulline;L-Ornithine, N5-(aminocarbonyl)-;Ornithine, N5-carbamoyl-, L- |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid |
| Molecular Weight | 175.19 g/mol |
| Molecular Formula | C6H13N3O3 |
| InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1 |
| InChI Key | RHGKLRLOHDJJDR-BYPYZUCNSA-N |
| Boiling Point | 306.5 °C |
| Melting Point | 214 °C |
| Purity | 95% |
| Density | 1.29 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.016 |
| Isomeric SMILES | C(C[C@@H](C(=O)O)N)CNC(=O)N |
| pKa | 2.43 |
If you have any questions, please contact us. You will get a satisfactory answer.
