Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0145 |
| Product Name | Cinoxate |
| CAS | 104-28-9 |
| Structure |  |
| Synonyms | 2-Ethoxyethyl p-methoxycinnamate;2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethoxyethyl ester;3-(4-Methoxyphenyl)-2-propenoic acid 2-ethoxyethyl ester;Cinnamic acid, p-methoxy-, 2-ethoxyethyl ester;Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethoxyethyl ester |
| IUPAC Name | 2-ethoxyethyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| Molecular Weight | 250.29 g/mol |
| Molecular Formula | C7H5NaO3 |
| InChI | InChI=1S/C14H18O4/c1-3-17-10-11-18-14(15)9-6-12-4-7-13(16-2)8-5-12/h4-9H,3,10-11H2,1-2H3/b9-6+ |
| InChI Key | CMDKPGRTAQVGFQ-RMKNXTFCSA-N |
| Boiling Point | 184-187 °C |
| Melting Point | -25 °C |
| Purity | 95% |
| Appearance | Liquid |
| Isomeric SMILES | CCOCCOC(=O)/C=C/C1=CC=C(C=C1)OC |
What is the chemical formula of cinoxate?
The chemical formula of cinoxate is C14H18O4.
What is the molecular weight of cinoxate?
The molecular weight of cinoxate is 250.29 g/mol.
What is the melting point of cinoxate?
The melting point of cinoxate is -24.9°C.
What is the boiling point of cinoxate?
The boiling point of cinoxate is 184-187°C.
How is cinoxate stored?
Cinoxate is stored in a refrigerator.
What is the main use of cinoxate?
Cinoxate is used as an ingredient in some types of sunscreens to protect skin against UV-A and UV-B rays.
What are some of the physical properties of cinoxate?
Cinoxate is a slightly yellow viscous liquid that is insoluble in water but miscible with alcohols, esters, and vegetable oils.
What is the approved usage level of cinoxate in sunscreen products?
The approved usage level of cinoxate in sunscreen products is 1 to 3 percent.
How does cinoxate react under acidic or alkaline conditions?
Cinoxate may hydrolyze under acidic or alkaline conditions.
If you have any questions, please contact us. You will get a satisfactory answer.
