Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1285 |
| Product Name | Cinnamic Acid |
| CAS | 140-10-3 |
| Structure |  |
| Synonyms | trans-Cinnamic acid |
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
| Molecular Weight | 148.16 g/mol |
| Molecular Formula | C9H8O2 |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
| InChI Key | WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| Boiling Point | 300 °C |
| Melting Point | 133 °C |
| Purity | 95% |
| Density | 1.25 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Isomeric SMILES | C1=CC=C(C=C1)/C=C/C(=O)O |
What are some synonyms for Cinnamic acid?
Some synonyms for Cinnamic acid are AKOS B004228, AKOS 233-01, and 3-PHENYLACRYLIC ACID.
What is the chemical formula for Cinnamic acid?
The chemical formula for Cinnamic acid is C9H8O2.
What is the melting point of Cinnamic acid?
The melting point of Cinnamic acid is 133 °C.
What is the primary use of Cinnamic acid in the perfume industry?
Cinnamic acid is mainly used in the perfume industry for the synthesis of methyl cinnamate, ethyl cinnamate, and cinnamic acid benzyl ester.
How is Cinnamic acid synthesized from benzaldehyde?
Cinnamic acid is synthesized from benzaldehyde through a Knoevenagel condensation reaction with malonic acid in the presence of weakly basic catalysts.
What is the role of Cinnamic acid in the pharmaceutical industry?
Cinnamic acid is used for the production of l-phenylalanine, which is the starting material for peptide sweeteners in the pharmaceutical industry.
What are some chemical properties of Cinnamic acid?
Cinnamic acid is almost odorless with a burning taste, and then turning sweet and reminiscent of apricot. It is also freely soluble in benzene, diethyl ether, acetone, and insoluble in hexane.
What safety information is available regarding Cinnamic acid?
Cinnamic acid has an acute oral LD50 of 2.5 g/kg in rats and is slightly irritating when applied to rabbit skin. It is considered GRAS (generally recognized as safe) by FEMA.
What are some uses of Cinnamic acid in chemical production?
Cinnamic acid is used as a corrosion inhibitor, a brightener in zinc electroplating baths, a heat stabilizer for poly(vinyl chloride), and a cross-linking agent for copolymers and polyurethanes.
What is a common production method for Cinnamic acid?
The Perkin reaction is a common method for producing Cinnamic acid commercially, where benzaldehyde is condensed with acetic anhydride in the presence of sodium acetate as a catalyst.
If you have any questions, please contact us. You will get a satisfactory answer.
