Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1249 |
| Product Name | Cholesteryl Succinate |
| CAS | 1510-21-0 |
| Structure |  |
| Synonyms | Cholesteryl hemisuccinate |
| IUPAC Name | 4-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
| Molecular Weight | 486.7 g/mol |
| Molecular Formula | C31H50O4 |
| InChI | InChI=1S/C31H50O4/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(35-29(34)14-13-28(32)33)15-17-30(22,4)27(24)16-18-31(25,26)5/h9,20-21,23-27H,6-8,10-19H2,1-5H3,(H,32,33)/t21-,23+,24+,25-,26+,27+,30+,31-/m1/s1 |
| InChI Key | WLNARFZDISHUGS-MIXBDBMTSA-N |
| Boiling Point | 586.0±43.0 °C |
| Melting Point | 178 °C |
| Purity | 0.98 |
| Density | 1.06 g/mL |
| Appearance | White to off-white solid |
| Highest Usage In Residency Products | 0.0224 |
| Isomeric SMILES | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OC(=O)CCC(=O)O)C)C |
| pKa | 4.40±0.17 |
If you have any questions, please contact us. You will get a satisfactory answer.
