Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1202 |
| Product Name | Cholesteryl Oleate |
| CAS | 303-43-5 |
| Structure |  |
| Synonyms | Cholest-5-en-3-beta-yl oleate;Cholest-5-en-3-ol (3beta)-, (9Z)-9-octadecenoate |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (Z)-octadec-9-enoate |
| Molecular Weight | 651.1 g/mol |
| Molecular Formula | C45H78O2 |
| InChI | InChI=1S/C45H78O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-43(46)47-38-30-32-44(5)37(34-38)26-27-39-41-29-28-40(36(4)24-22-23-35(2)3)45(41,6)33-31-42(39)44/h14-15,26,35-36,38-42H,7-13,16-25,27-34H2,1-6H3/b15-14-/t36-,38+,39+,40-,41+,42+,44+,45-/m1/s1 |
| InChI Key | RJECHNNFRHZQKU-RMUVNZEASA-N |
| Boiling Point | 618 °C |
| Melting Point | 44-47 °C |
| Purity | 95% |
| Density | 0.93 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.005 |
| Isomeric SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CC[C@@H]4[C@H](C)CCCC(C)C)C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
