Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1193 |
| Product Name | Cholesteryl Chloride |
| CAS | 910-31-6 |
| Structure |  |
| Synonyms | 3-beta-Chlorocholest-5-ene;Cholest-5-ene, 3-chloro-, (3beta)-;Cholest-5-ene, 3beta-chloro-;3-Chlorocholest-5-ene |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-3-chloro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| Molecular Weight | 405.1 g/mol |
| Molecular Formula | C27H45Cl |
| InChI | InChI=1S/C27H45Cl/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChI Key | OTVRYZXVVMZHHW-DPAQBDIFSA-N |
| Boiling Point | 488.5 °C |
| Melting Point | 94-96 °C |
| Purity | 95% |
| Density | 0.92 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.009 |
| Isomeric SMILES | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)Cl)C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
