Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1226 |
| Product Name | Cholesteryl Butyrate |
| CAS | 521-13-1 |
| Structure |  |
| Synonyms | Cholest-5-en-3-ol (3beta)-, butanoate;Cholesteryl butyrate |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanoate |
| Molecular Weight | 456.7 g/mol |
| Molecular Formula | C31H52O2 |
| InChI | InChI=1S/C31H52O2/c1-7-9-29(32)33-24-16-18-30(5)23(20-24)12-13-25-27-15-14-26(22(4)11-8-10-21(2)3)31(27,6)19-17-28(25)30/h12,21-22,24-28H,7-11,13-20H2,1-6H3/t22-,24+,25+,26-,27+,28+,30+,31-/m1/s1 |
| InChI Key | CKDZWMVGDHGMFR-GTPODGLVSA-N |
| Boiling Point | 518.0±29.0 °C |
| Melting Point | 98-100 °C |
| Purity | 95% |
| Density | 0.98 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0095 |
| Isomeric SMILES | CCCC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CC[C@@H]4[C@H](C)CCCC(C)C)C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
