Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0010 |
| Product Name | Chloroxylenol |
| CAS | 88-04-0 |
| Structure |  |
| Synonyms | Chloroxylenol;p-Chloro-m-xylenol;Phenol, 4-chloro-3,5-dimethyl-;4-Chloro-3,5-xylenol |
| IUPAC Name | 4-chloro-3,5-dimethylphenol |
| Molecular Weight | 156.61 g/mol |
| Molecular Formula | C8H9ClO |
| InChI | InChI=1S/C8H9ClO/c1-5-3-7(10)4-6(2)8(5)9/h3-4,10H,1-2H3 |
| InChI Key | OSDLLIBGSJNGJE-UHFFFAOYSA-N |
| Boiling Point | 246 °C |
| Melting Point | 114-116 °C |
| Flash Point | 132 °C |
| Purity | 95% |
| Density | 0.67 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=CC(=CC(=C1Cl)C)O |
| pKa | 9.76±0.23 |
What is the chemical formula for Chloroxylenol?
The chemical formula for Chloroxylenol is C8H9ClO.
What is the boiling point of 4-Chloro-3,5-dimethylphenol?
The boiling point of 4-Chloro-3,5-dimethylphenol is 246 °C.
What color is Chloroxylenol in its crystalline form?
Chloroxylenol is white to light beige in color in its crystalline form.
What is the primary usage of Chloroxylenol?
Chloroxylenol is primarily used as an antiseptic and germicide, for mildew prevention, and as an antibacterial and topical antiseptic.
How is Chloroxylenol produced?
Chloroxylenol is prepared by treating 3,5-dimethylphenol with chlorine or sulfuryl chloride.
What is the therapeutic function of Chloroxylenol?
The therapeutic function of Chloroxylenol is as a topical antiseptic and disinfectant.
What is the LD50 of Chloroxylenol when orally ingested by a rabbit?
The LD50 of Chloroxylenol when orally ingested by a rabbit is 3830 mg/kg.
What kind of safety hazards are associated with Chloroxylenol?
Chloroxylenol is classified as an irritant and can be toxic when ingested. It is also an eye irritant and poses risks of self-poisoning if ingested.
How should Chloroxylenol be stored to maintain stability?
Chloroxylenol should be stored in polyethylene, mild steel, or stainless steel containers, kept in a cool, dry place, and protected from microbial contamination.
What is the regulatory status of Chloroxylenol in cosmetic products in Europe?
Chloroxylenol is approved in Europe as a preservative in cosmetics with a maximum authorized concentration of 0.5%.
If you have any questions, please contact us. You will get a satisfactory answer.
