Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0297 |
| Product Name | 2-Chloro-p-Phenylenediamine Sulfate |
| CAS | 6219-71-2 |
| Structure |  |
| Synonyms | 3-Chloro-4-aminoanilinesulfate |
| IUPAC Name | 2-chlorobenzene-1,4-diamine;sulfuric acid |
| Molecular Weight | 240.66 g/mol |
| Molecular Formula | C6H9ClN2O4S |
| InChI | InChI=1S/C6H7ClN2.H2O4S/c7-5-3-4(8)1-2-6(5)9;1-5(2,3)4/h1-3H,8-9H2;(H2,1,2,3,4) |
| InChI Key | GQFGHCRXPLROOF-UHFFFAOYSA-N |
| Purity | 0.98 |
| Density | 1.35 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=C(C=C1N)Cl)N.OS(=O)(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
