Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0286 |
| Product Name | 2-Chloro-p-Phenylenediamine |
| CAS | 615-66-7 |
| Structure |  |
| Synonyms | 2-Chloro-1,4-diaminobenzene |
| IUPAC Name | 2-chlorobenzene-1,4-diamine |
| Molecular Weight | 142.59 g/mol |
| Molecular Formula | C6H7ClN2 |
| InChI | InChI=1S/C6H7ClN2/c7-5-3-4(8)1-2-6(5)9/h1-3H,8-9H2 |
| InChI Key | MGLZGLAFFOMWPB-UHFFFAOYSA-N |
| Boiling Point | 232.49 °C |
| Melting Point | 62-66 °C |
| Purity | 0.97 |
| Density | 1.21 g/mL |
| Appearance | Dark green to black solid |
| Isomeric SMILES | C1=CC(=C(C=C1N)Cl)N |
If you have any questions, please contact us. You will get a satisfactory answer.
