Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0054 |
| Product Name | Chlorhexidine digluconate |
| CAS | 18472-51-0 |
| Structure |  |
| Synonyms | Chlorhexidine gluconate |
| IUPAC Name | (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| Molecular Weight | 897.76 g/mol |
| Molecular Formula | C22H30Cl2N10.2C6H12O7 |
| InChI | InChI=1S/C22H30Cl2N10.2C6H12O7/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18;2*7-1-2(8)3(9)4(10)5(11)6(12)13/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34);2*2-5,7-11H,1H2,(H,12,13)/t;2*2-,3-,4+,5-/m.11/s1 |
| InChI Key | YZIYKJHYYHPJIB-UUPCJSQJSA-N |
| Purity | 0.98 |
| Density | 1.06 g/mL |
| Appearance | Liquide |
| Storage | 2-8°C |
| Isomeric SMILES | C1=CC(=CC=C1N/C(=N/C(=NCCCCCCN=C(/N=C(/NC2=CC=C(C=C2)Cl)\N)N)N)/N)Cl.C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O.C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
