Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-FC-0054 |
Product Name | Chlorhexidine digluconate |
CAS | 18472-51-0 |
Structure | ![]() |
Synonyms | Chlorhexidine gluconate |
IUPAC Name | (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
Molecular Weight | 897.76 g/mol |
Molecular Formula | C22H30Cl2N10.2C6H12O7 |
InChI | InChI=1S/C22H30Cl2N10.2C6H12O7/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18;2*7-1-2(8)3(9)4(10)5(11)6(12)13/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34);2*2-5,7-11H,1H2,(H,12,13)/t;2*2-,3-,4+,5-/m.11/s1 |
InChI Key | YZIYKJHYYHPJIB-UUPCJSQJSA-N |
Purity | 0.98 |
Density | 1.06 g/mL |
Appearance | Liquide |
Storage | 2-8°C |
Isomeric SMILES | C1=CC(=CC=C1N/C(=N/C(=NCCCCCCN=C(/N=C(/NC2=CC=C(C=C2)Cl)\N)N)N)/N)Cl.C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O.C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O |
What is Chlorhexidine Digluconate used for in personal care products?
Chlorhexidine Digluconate is a versatile ingredient prominently used for its antibacterial and antifungal properties. In skincare, it is found in cleansers, toners, and acne treatments, helping to control bacteria and prevent infections. Additionally, it plays a crucial role in wound care by promoting healing while preventing infection. In hair care products, such as shampoos and conditioners, it helps prevent dandruff and scalp infections, effectively inhibiting the growth of bacteria and fungi on the scalp and hair.
How is Chlorhexidine Digluconate synthesized?
Chlorhexidine Digluconate is synthesized through the esterification of chlorhexidine base and gluconic acid. This process results in a yellowish-brown aqueous solution containing 20% Chlorhexidine Digluconate. The synthesis process is meticulously controlled to ensure the purity and quality of the final product, making it suitable for use in various formulations.
What role does Chlorhexidine Digluconate play in formulations?
Chlorhexidine Digluconate serves several roles in formulations. Primarily, it acts as an antimicrobial agent, providing effective protection against a wide range of microorganisms. Its use in oral care products is well-recognized, and as a preservative, it helps extend the shelf life of cosmetic and personal care products by preventing the growth of bacteria and fungi.
Is Chlorhexidine Digluconate safe to use in skincare products?
Chlorhexidine Digluconate is generally considered safe for use in cosmetic and personal care products. However, it is recommended to perform a patch test prior to use, particularly for those with sensitive skin. It is unlikely to clog pores as it is not oil-based, making it non-comedogenic. While Chlorhexidine Digluconate is synthetic and typically considered vegan, the labeling may depend on specific sourcing and production processes involved.
Can Chlorhexidine Digluconate be considered vegan?
Chlorhexidine Digluconate is a synthetic compound, typically considered vegan due to its non-animal derived origins. However, whether it is labeled vegan can depend on the source and production processes of the ingredient used in a specific product. It is advisable to check with the manufacturer for specific product formulations.