Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0094 |
| Product Name | Cellulose gum |
| CAS | 9004-32-4 |
| Structure |  |
| Synonyms | Carboxyl methyl cellulose sodium |
| IUPAC Name | sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
| Molecular Weight | 262.19 g/mol |
| Molecular Formula | C8H15NaO8 |
| InChI | InChI=1S/C6H12O6.C2H4O2.Na/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4;/h1,3-6,8-12H,2H2;1H3,(H,3,4);/q;;+1/p-1 |
| InChI Key | QMGYPNKICQJHLN-UHFFFAOYSA-M |
| Melting Point | 274 °C |
| Density | 1.6 g/mL |
| Appearance | White to light yellow solid |
| Isomeric SMILES | CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
| pKa | 4.3 |
What is the chemical formula of sodium carboxymethyl cellulose?
The chemical formula of sodium carboxymethyl cellulose is C6H7O2(OH)2CH2COONa.
What is the solubility of sodium carboxymethyl cellulose in water?
Sodium carboxymethyl cellulose is soluble in water at a concentration of 20 mg/mL.
How does sodium carboxymethyl cellulose react with mono chloroacetic acid to form CMC?
Sodium carboxymethyl cellulose is formed when cellulose reacts with mono chloroacetic acid or its sodium salt under alkaline conditions, with hydroxyl groups substituted by sodium carboxymethyl groups in C2, C3, and C6 positions of glucose.
What are some common uses of sodium carboxymethyl cellulose?
Sodium carboxymethyl cellulose is used in food additives, drilling muds, detergents, paints, adhesives, printing inks, textiles, pharmaceuticals, and more.
How is sodium carboxymethyl cellulose synthesized?
Sodium carboxymethyl cellulose is manufactured through processes that replace some of the hydrogen atoms in the hydroxyl groups of the cellulose molecule with acidic carboxymethyl groups, which are neutralized to form the corresponding sodium salt.
What are some safety considerations for sodium carboxymethyl cellulose?
Sodium carboxymethyl cellulose is mildly toxic by ingestion and can have a laxative effect in large amounts. It is generally regarded as safe for use in oral, topical, and parenteral formulations, cosmetics, toiletries, and food products.
What are some of the physical properties of sodium carboxymethyl cellulose?
Sodium carboxymethyl cellulose is a white to light yellow, odorless, tasteless, granular powder that is stable and soluble in water.
What are some specific product features of carboxymethyl cellulose?
Carboxymethyl cellulose is a tackifier, stable, soluble in water, neutral or alkaline, and forms a viscous liquid with adhesive, thickening, flowing, and other characteristics.
How is sodium carboxymethyl cellulose used in the pharmaceutical industry?
Sodium carboxymethyl cellulose is used in oral and topical pharmaceutical formulations as a viscosity-increasing agent, suspending agent, tablet binder, disintegrant, and more.
What are some examples of industry applications for sodium carboxymethyl cellulose?
Sodium carboxymethyl cellulose is used in oil drilling, detergents, food production, textiles, construction, and various other industries for its thickening, stabilizing, and adhesive properties.
If you have any questions, please contact us. You will get a satisfactory answer.
