Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0094 |
| Product Name | Cellulose gum |
| CAS | 9004-32-4 |
| Structure |  |
| Synonyms | Carboxyl methyl cellulose sodium |
| IUPAC Name | sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
| Molecular Weight | 262.19 g/mol |
| Molecular Formula | C8H15NaO8 |
| InChI | InChI=1S/C6H12O6.C2H4O2.Na/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4;/h1,3-6,8-12H,2H2;1H3,(H,3,4);/q;;+1/p-1 |
| InChI Key | QMGYPNKICQJHLN-UHFFFAOYSA-M |
| Melting Point | 274 °C |
| Density | 1.6 g/mL |
| Appearance | White to light yellow solid |
| Isomeric SMILES | CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
| pKa | 4.3 |
Cellulose gum, derived from cellulose-a polysaccharide found primarily in green plants-serves various purposes in the personal care industry. As a chemically inert thickening agent, it excels at binding ingredients in cosmetic formulations while maintaining compatibility with most additives and proteins. Its multifunctional nature allows it to effectively control the thixotropy, suspension, adhesion, flow, and lubrication properties of products. Consequently, cellulose gum is frequently used in a wide range of applications, including toothpaste, hair dye powders, liquid makeup, mascara, and eyeliners, where it functions as a gelling agent, abrasive, and foam stabilizer.
What is Cellulose Gum and where does it come from?
Cellulose Gum is a multifunctional ingredient used primarily in the cosmetics and personal care industry. It is derived from cellulose, which is the primary component of green plants. Cellulose itself is an organic polysaccharide that comes from beta-glucose.
What are the main functions of Cellulose Gum in cosmetics?
In cosmetic formulations, Cellulose Gum serves multiple functions. It acts as a thickening agent, binder, gelling agent, abrasive, and foam stabilizer. These properties make it a key component in a wide range of personal care products.
Is Cellulose Gum chemically reactive with other ingredients?
No, Cellulose Gum is chemically inert, meaning it does not react with other ingredients. It is compatible with almost all additives and proteins, maintaining its viscosity even when mixed with various components.
How does Cellulose Gum benefit toothpaste formulations?
In toothpaste, Cellulose Gum helps in controlling the thixotropy, suspension, adhesion, flow, and lubrication properties. This ensures that the toothpaste remains stable, effectively binds its ingredients, and provides a smooth application.
In what other cosmetic products is Cellulose Gum commonly used?
Beyond toothpaste, Cellulose Gum is also a common ingredient in products such as hair dye powders, liquid makeup, mascara, and eyeliners. Its versatility and effectiveness in controlling product texture and stability make it a preferred choice for formulating these items.
If you have any questions, please contact us. You will get a satisfactory answer.
