Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1215 |
| Product Name | Cedrol |
| CAS | 77-53-2 |
| Structure |  |
| Synonyms | (1S,2R,5S,7R,8R)-2,6,6,8-Tetramethyltricyclo[5.3.1.0]undecan-8-ol |
| IUPAC Name | (1S,2R,5S,7R,8R)-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecan-8-ol |
| Molecular Weight | 222.37 g/mol |
| Molecular Formula | C15H26O |
| InChI | InChI=1S/C15H26O/c1-10-5-6-11-13(2,3)12-9-15(10,11)8-7-14(12,4)16/h10-12,16H,5-9H2,1-4H3/t10-,11+,12-,14-,15+/m1/s1 |
| InChI Key | SVURIXNDRWRAFU-OGMFBOKVSA-N |
| Boiling Point | 273 °C |
| Melting Point | 55-59 °C |
| Purity | 95% |
| Density | 0.95 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.005 |
| Isomeric SMILES | C[C@@H]1CC[C@@H]2[C@]13CC[C@@]([C@H](C3)C2(C)C)(C)O |
What is the chemical formula of Cedrol?
The chemical formula of Cedrol is C15H26O.
What is the melting point of Cedrol?
The melting point of Cedrol is 55-59 °C.
In what solvents is Cedrol soluble?
Cedrol is soluble in DMSO (10 mg/ml).
What is the odor of Cedrol?
The odor of Cedrol is described as cedarwood, woody, dry, sweet, and soft.
From which conifers is Cedrol mainly found?
Cedrol is mainly found in conifers of the genera Cupressus, Juniperus, and Cedrus.
What is the color of Cedrol?
Cedrol is white in color.
What is the primary usage of Cedrol?
Cedrol is used as an acaricide and to enhance skin ECM production.
How can Cedrol be prepared?
Cedrol can be prepared from cedarwood by fractional distillation followed by recrystallization from suitable solvents of appropriate solid fractions.
In what type of products can Cedrol be used as a fragrance ingredient?
Cedrol can be used as a fragrance ingredient in cosmetics, shampoos, soaps, cleaners, and detergents.
What are some of the anticancer activities associated with Cedrol?
Cedrol has been found to possess significant anticancer activity against glioblastoma, human renal adenocarcinoma, and amelanotic melanoma cells, inducing autophagy and apoptosis in various cancer cells.
If you have any questions, please contact us. You will get a satisfactory answer.
