Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1148 |
| Product Name | Carnitine HCl |
| CAS | 6645-46-1 |
| Structure |  |
| Synonyms | Carnitine Hydrochloride |
| IUPAC Name | [(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium;chloride |
| Molecular Weight | 197.66 g/mol |
| Molecular Formula | C7H16ClNO3 |
| InChI | InChI=1S/C7H15NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H/t6-;/m1./s1 |
| InChI Key | JXXCENBLGFBQJM-FYZOBXCZSA-N |
| Melting Point | 142 °C |
| Purity | 95% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.008 |
| Isomeric SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)O.[Cl-] |
If you have any questions, please contact us. You will get a satisfactory answer.
