Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0065 |
| Product Name | Caramel |
| CAS | 8028-89-5 |
| Synonyms | Burnt sugar coloring matter |
| IUPAC Name | 3,5-dimethylcyclopentane-1,2-dione |
| Molecular Weight | 126.15 g/mol |
| Molecular Formula | C7H10O2 |
| InChI | InChI=1S/C7H10O2/c1-4-3-5(2)7(9)6(4)8/h4-5H,3H2,1-2H3 |
| InChI Key | MIDXCONKKJTLDX-UHFFFAOYSA-N |
| Density | 1.35 g/mL |
| Isomeric SMILES | CC1CC(C(=O)C1=O)C |
Caramel, a product derived from the controlled heating of sucrose, is widely utilized as a water-soluble colorant in decorative cosmetics and skincare products. During the caramelization process, sucrose, a disaccharide, breaks down into glucose and fructose, leading to the formation of various compounds that enhance the product's functionality. Caramel not only imparts an appealing hue but also offers benefits similar to those of mono- and polysaccharides. Its saccharide molecules, rich in hydroxy groups, effectively attract water and penetrate the epidermis, ensuring optimal hydration and minimizing transdermal moisture loss. Additionally, caramel is a valuable source of glucose, providing energy to skin cells, aiding in ATP generation, and supporting hyaluronic acid production. This process energizes cells, boosting their metabolism and renewal. Furthermore, difructose anhydride within caramel acts as a probiotic, promoting a balanced microbiota and a healthy skin appearance. The antioxidant properties inherent in saccharides contribute to the protection of skin cell membranes and DNA against free radicals and oxidative stress. Overall, caramel serves as a natural ingredient that delivers multiple benefits, including tanning, energizing, protecting, and moisturizing, for a radiant and healthy complexion.
What is Caramel, and how is it produced?
Caramel is a product derived from the controlled heating of sugar, specifically sucrose. This process, known as caramelization, involves breaking down sucrose into monosaccharides like glucose and fructose and further processing them through isomerization and polymerization. The result is a variety of compounds, including di- and trisaccharides and anhydrides, which give caramel its distinctive properties. These properties make caramel an ideal water-soluble pigment used in decorative cosmetics and skincare products.
What are the benefits of using Caramel in skincare products?
Caramel provides several benefits in skincare due to its similarity to mono- and polysaccharides. The saccharide molecules present in caramel contain numerous hydroxy groups, which are effective at attracting water molecules and penetrating the epidermis. This action ensures optimal hydration and minimizes transdermal moisture loss. Additionally, caramel serves as a source of glucose for energy generation and hyaluronic acid production in skin cells, enhancing cellular functions, metabolism, and renewal. Its antioxidant properties help protect skin cell membranes and DNA from free radicals and oxidative stress.
How does Caramel support skin health and appearance?
Caramel acts as a natural "candy" for the skin by providing moisturizing, energizing, and protective actions. It helps maintain a healthy complexion by energizing skin cells, promoting their function and renewal, and balancing microbiota with its difructose anhydride, which acts as a probiotic for beneficial bacteria. These properties contribute to a beautiful, glowing, and healthy skin appearance.
Can Caramel contribute to skin hydration?
Yes, Caramel is effective at providing skin hydration. The saccharide molecules within caramel possess numerous hydroxy groups that attract and retain water molecules, aiding in the penetration into the epidermis. This capability supports optimal skin hydration and reduces the loss of moisture through the skin, contributing to healthy, well-hydrated skin.
Does Caramel offer any antioxidant benefits?
Caramel exhibits antioxidant effects that benefit the skin. It protects skin cell membranes and DNA from damage caused by free radicals and oxidative stress, which are known to contribute to skin aging and damage. By incorporating caramel into skincare routines, users can help safeguard their skin from these harmful effects, leading to healthier and more resilient skin.
If you have any questions, please contact us. You will get a satisfactory answer.
