Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1260 |
| Product Name | Camphanediol |
| CAS | 56614-57-4 |
| Structure |  |
| Synonyms | (1R,2S,3R,4S)-rel-1,7,7-Trimethylbicyclo[2.2.1]heptane-2,3-diol |
| IUPAC Name | (1R,2S,3R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol |
| Molecular Weight | 170.25 g/mol |
| Molecular Formula | C10H18O2 |
| InChI | InChI=1S/C10H18O2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6-8,11-12H,4-5H2,1-3H3/t6-,7-,8-,10+/m1/s1 |
| InChI Key | AYEOSGBMQHXVER-DQUBFYRCSA-N |
| Melting Point | 262-268 °C |
| Purity | 95% |
| Density | 1.12 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C[C@@]12CC[C@@H](C1(C)C)[C@H]([C@H]2O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
