Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0081 |
| Product Name | Calcium Pyrophosphate |
| CAS | 7790-76-3 |
| Structure |  |
| Synonyms | Diphosphoricacid,calciumsalt |
| IUPAC Name | dicalcium;phosphonato phosphate |
| Molecular Weight | 254.1 g/mol |
| Molecular Formula | Ca2O7P2 |
| InChI | InChI=1S/2Ca.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+2;/p-4 |
| InChI Key | JUNWLZAGQLJVLR-UHFFFAOYSA-J |
| Melting Point | 1230 °C |
| Purity | 95% |
| Density | 3.09 g/mL |
| Appearance | Solid |
| Isomeric SMILES | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Ca+2].[Ca+2] |
If you have any questions, please contact us. You will get a satisfactory answer.
