Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0242 |
| Product Name | Calcium Pantothenate |
| CAS | 137-08-6 |
| Structure |  |
| Synonyms | Pantothenic acid, calcium salt (2:1), D- |
| IUPAC Name | calcium;3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoate |
| Molecular Weight | 476.5 g/mol |
| Molecular Formula | C18H32CaN2O10 |
| InChI | InChI=1S/2C9H17NO5.Ca/c2*1-9(2,5-11)7(14)8(15)10-4-3-6(12)13;/h2*7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13);/q;;+2/p-2/t2*7-;/m00./s1 |
| InChI Key | FAPWYRCQGJNNSJ-UBKPKTQASA-L |
| Melting Point | 190 °C |
| Purity | 95% |
| Solubility | Soluble in water |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.045 |
| Isomeric SMILES | CC(C)(CO)[C@H](C(=O)NCCC(=O)[O-])O.CC(C)(CO)[C@H](C(=O)NCCC(=O)[O-])O.[Ca+2] |
Calcium pantothenate, the calcium salt derivative of pantothenic acid or Vitamin B5, is widely utilized due to its stability and extended product shelf-life compared to sodium salt or pure pantothenic acid. This white odorless powder which has a slightly sweet taste followed by a mildly bitter aftertaste, is frequently employed in the food industry as a vitamin additive enhancing nutritional value in powdered preparations, beverages, breakfast cereals, chocolate drinks and nut/chocolate creams. Notably, 1 mg of D-calcium pantothenate equates to 0.92 mg of pantothenic acid. Its applications extend to skincare, where it promotes skin fibroblast migration and proliferation suppresses free radicals and enhances collagen and elastin production, making it invaluable for healing firming and renewing skin. This is particularly essential for scar treatment skin transplantation and burn care as well as various dermatoses, as it supports epithelization granulation and dermal cell migration considerably improving healing and recovery. In hair care, calcium pantothenate a stable and water-soluble form of vitamin B5 participates in vital metabolic processes, aiding in moisture retention cell growth and tissue regeneration combating inflammation and facilitating tissue repair, thereby effectively stimulating hair growth.
What is Calcium Pantothenate and why is it used in various formulations?
Calcium Pantothenate is the calcium salt of Pantothenic acid, also known as Vitamin B5. It is favored in formulations because it is more stable compared to sodium salt or pure pantothenic acid, contributing to a longer shelf-life of the products. This makes it an ideal ingredient for use in a variety of food and cosmetic applications.
In what kinds of products is Calcium Pantothenate commonly found?
Calcium Pantothenate is commonly used in the food industry as a vitamin additive. It is often found in powder-type preparations such as vitamin-fortified beverages, breakfast cereals, chocolate drinks, and nut/chocolate creams. It is also incorporated in skin and hair care products due to its beneficial effects on skin and hair health.
What benefits does Calcium Pantothenate offer for skin health?
Calcium Pantothenate positively affects the migration and proliferation of skin fibroblasts and stimulates fibroblast activity. It helps suppress free radicals and enhances the production of collagen and elastin, which are essential for healing, firming, and renewing the skin. It is particularly beneficial for scar treatment, skin transplantation, burn injuries, and various dermatoses due to its ability to stimulate epithelization and dermal cell migration.
How does Calcium Pantothenate benefit hair care?
As a water-soluble and stable form of Vitamin B5, Calcium Pantothenate plays a crucial role in several metabolic processes that impact hair health. It helps maintain moisture levels in the hair, stimulates cell growth and tissue regeneration, reduces inflammation, and aids in tissue recovery. These actions collectively contribute to healthier hair and have been shown to stimulate hair growth.
How does the effectiveness of Calcium Pantothenate compare to that of pure Pantothenic Acid?
In terms of effectiveness, 1 mg of D-calcium pantothenate in dry matter is equivalent to 0.92 mg of pantothenic acid. The conversion factor allows for consistent vitamin B5 benefits while leveraging the increased stability of Calcium Pantothenate compared to pure Pantothenic Acid, making it more advantageous in various applications.
If you have any questions, please contact us. You will get a satisfactory answer.
