Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0247 |
| Product Name | Bis-Aminopropyl Dimethicone |
| CAS | 106214-84-0 |
| Structure |  |
| Synonyms | Aminopropylpolydimethylsiloxane |
| IUPAC Name | 3-[[[3-aminopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propan-1-amine |
| Molecular Weight | 322.67 g/mol |
| Molecular Formula | C12H34N2O2Si3 |
| InChI | InChI=1S/C12H34N2O2Si3/c1-17(2,11-7-9-13)15-19(5,6)16-18(3,4)12-8-10-14/h7-14H2,1-6H3 |
| InChI Key | ZWRBLCDTKAWRHT-UHFFFAOYSA-N |
| Boiling Point | >200 °C |
| Melting Point | <-60 °C |
| Purity | 95% |
| Density | 0.98 g/mL |
| Appearance | Liquid |
| Highest Usage In Rinsing Products | 0.05 |
| Isomeric SMILES | C[Si](C)(CCCN)O[Si](C)(C)O[Si](C)(C)CCCN |
If you have any questions, please contact us. You will get a satisfactory answer.
