Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0206 |
| Product Name | Biotin |
| CAS | 58-85-5 |
| Structure |  |
| Synonyms | D-Biotin |
| Description | Biotin is a type of B-complex vitamin that plays an important role in maintaining healthy skin, hair, and nails. |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
| Molecular Weight | 244.31 g/mol |
| Molecular Formula | C10H16N2O3S |
| Canonical SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)O)NC(=O)N2 |
| InChI | YBJHBAHKTGYVGT-ZKWXMUAHSA-N |
| InChI Key | InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1 |
| Boiling Point | 573.5±35.0 °C |
| Melting Point | 231-233 °C(lit.) |
| Flash Point | 300.7°C |
| Density | 1.269 g/mL |
| Solubility | water, 220 mg/L @ 25 °C (exp) |
| Appearance | white or off-white crystalline powder |
| Application | 1. Biotin is essential for a healthy metabolism and helps convert carbohydrates, fats, and proteins into energy. 2. Biotin is used in dietary supplements to support healthy hair, skin, and nails. 3. Biotin is used in cosmetics and skin care products due to its ability to improve hair and skin health. 4. Biotin is used in the food industry as a supplement to improve the nutritional content of foods. 5. Biotin is used in agriculture to improve the growth and health of crops and plants. |
| Features And Benefits | 1. Promotes hair growth 2. Strengthens hair 3. Improves skin health 4. Moisturizes skin 5. Helps to reduce acne 6. Acts as a natural sunscreen 7. May help to reduce the appearance of fine lines and wrinkles. |
| pH | 4.5 (0.1g/l, H2O) |
Biotin often referred to as vitamin B7 or the "beauty vitamin", plays a crucial role in maintaining healthy skin and hair by activating metabolism and promoting optimal hair growth and appearance. Individuals with a biotin deficiency may experience symptoms such as dull dry skin inflammation premature wrinkles and increased susceptibility to certain conditions like seborrheic dermatitis which is characterized by red scaly rashes. Furthermore, biotin deficiency can lead to weakened hair and excessive hair loss. Replenishing biotin can help manage these issues by restoring the skin's oil balance, reducing the likelihood of acne and helping to prevent dandruff. While there is no conclusive evidence suggesting that biotin supplementation benefits skin in those without a deficiency, maintaining adequate biotin levels is vital for those looking to support their skin and hair health comprehensively.
What is Biotin and why is it important for skin health?
Biotin, also known as vitamin B7, plays a vital role in ensuring healthy skin. Without adequate biotin levels, the skin can appear dull and dry, leading to wrinkles and premature aging. It also helps in balancing the skin's oil production and reducing the risk of conditions such as seborrheic dermatitis. By activating the metabolism, biotin helps rejuvenate and restore skin vitality.
Can Biotin supplementation improve skin health for everyone?
While biotin is essential for maintaining healthy skin, studies have shown that supplementation benefits are most notable in individuals with a biotin deficiency. There is no substantial evidence to suggest that additional biotin has skin benefits in those who do not have a deficiency. Hence, it's important to determine if there's a deficiency before considering supplementation.
Are there any visible signs of Biotin deficiency on the skin?
Yes, a biotin deficiency can lead to noticeable skin problems, such as red, scaly rashes and inflammation. Additionally, individuals with a deficiency might experience seborrheic dermatitis, characterized by red skin and dandruff, particularly on the scalp.
How does Biotin affect hair health and why is it called the "beauty vitamin"?
Biotin is crucial for hair health as it prevents weakening and excessive hair loss, promoting growth and strength. By nourishing hair and restoring its natural oil balance, biotin helps prevent dandruff and even contributes to reducing acne. These properties are why it's often referred to as the "beauty vitamin."
Is it possible to have too much Biotin, and what should one consider when taking supplements?
While maintaining adequate biotin levels is important, balance is key, as excessive supplementation without medical advice is unnecessary for individuals without a deficiency. Always consult a healthcare provider before starting any new vitamin regimen to ensure it's appropriate and safe for your individual health needs.
If you have any questions, please contact us. You will get a satisfactory answer.
