Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0206 |
| Product Name | Biotin |
| CAS | 58-85-5 |
| Structure |  |
| Synonyms | D-Biotin |
| Description | Biotin is a type of B-complex vitamin that plays an important role in maintaining healthy skin, hair, and nails. |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
| Molecular Weight | 244.31 g/mol |
| Molecular Formula | C10H16N2O3S |
| Canonical SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)O)NC(=O)N2 |
| InChI | YBJHBAHKTGYVGT-ZKWXMUAHSA-N |
| InChI Key | InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1 |
| Boiling Point | 573.5±35.0 °C |
| Melting Point | 231-233 °C(lit.) |
| Flash Point | 300.7°C |
| Density | 1.269 g/mL |
| Solubility | water, 220 mg/L @ 25 °C (exp) |
| Appearance | white or off-white crystalline powder |
| Application | 1. Biotin is essential for a healthy metabolism and helps convert carbohydrates, fats, and proteins into energy. 2. Biotin is used in dietary supplements to support healthy hair, skin, and nails. 3. Biotin is used in cosmetics and skin care products due to its ability to improve hair and skin health. 4. Biotin is used in the food industry as a supplement to improve the nutritional content of foods. 5. Biotin is used in agriculture to improve the growth and health of crops and plants. |
| Features And Benefits | 1. Promotes hair growth 2. Strengthens hair 3. Improves skin health 4. Moisturizes skin 5. Helps to reduce acne 6. Acts as a natural sunscreen 7. May help to reduce the appearance of fine lines and wrinkles. |
| pH | 4.5 (0.1g/l, H2O) |
What is the chemical formula of Biotin?
The chemical formula of Biotin is C10H16N2O3S.
What is the melting point of Biotin?
The melting point of Biotin is 231-233 °C.
How should Biotin be stored?
Biotin should be stored at 2-8°C.
What is the appearance of Biotin?
Biotin is a white crystalline substance.
How is Biotin activated in the body?
Biotin is activated by polarization of the O and N-1'atoms of the ureido nucleus, leading to increased nucleophilicity at N-1'.
What is the biological activity isomer of Biotin?
Only the (+)-isomer (d-biotin) of Biotin has biological activity.
What are some claimed uses of Biotin in cosmetics?
Some cosmetic manufacturers claim that Biotin has healing properties and is a good ingredient for treating acne skin.
In which foods can Biotin be found?
Biotin can be found in eggs, liver, peanuts, milk, and meat.
What is the essential function of Biotin in the body?
Biotin functions in the metabolism of carbohydrates, proteins, and fats.
What is another name for Biotin?
Another name for Biotin is Vitamin H.
If you have any questions, please contact us. You will get a satisfactory answer.
