Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0003 |
| Product Name | Betaine Salicylate |
| CAS | 17671-53-3 |
| Structure |  |
| Synonyms | Carboxymethyl(trimethyl)azanium,2-carboxyphenolate |
| IUPAC Name | carboxymethyl(trimethyl)azanium;2-carboxyphenolate |
| Molecular Weight | 255.27 g/mol |
| Molecular Formula | C12H17NO5 |
| InChI | InChI=1S/C7H6O3.C5H11NO2/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5(7)8/h1-4,8H,(H,9,10);4H2,1-3H3 |
| InChI Key | CFXSFDXXYYHZFU-UHFFFAOYSA-N |
| Melting Point | 107-109 °C |
| Purity | 95% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Isomeric SMILES | C[N+](C)(C)CC(=O)O.C1=CC=C(C(=C1)C(=O)O)[O-] |
If you have any questions, please contact us. You will get a satisfactory answer.
