Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0052 |
| Product Name | Beta-Carotene |
| CAS | 7235-40-7 |
| Structure |  |
| Synonyms | Beta-Carotene, all-trans-;CI 7513;Food Orange 5 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
| Molecular Weight | 536.87 g/mol |
| Molecular Formula | C40H56 |
| InChI | InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-22,25-28H,15-16,23-24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ |
| InChI Key | OENHQHLEOONYIE-JLTXGRSLSA-N |
| Boiling Point | 645 °C |
| Melting Point | 178-179 °C |
| Flash Point | 103 °C |
| Purity | 95% |
| Density | 1 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(CCCC2(C)C)C)\C)\C)/C)/C |
What is the molecular formula of Beta-Carotene?
The molecular formula of Beta-Carotene is C40H56.
What is the melting point of Beta-Carotene?
The melting point of Beta-Carotene is 178-179°C.
What are the synonyms of Beta-Carotene?
Some synonyms of Beta-Carotene include SOLATENE, PROVITAMIN A1, and TRANS-B-CAROTENE.
What are the hazard codes associated with Beta-Carotene?
The hazard codes associated with Beta-Carotene are Xn.
What are the physical properties of Beta-Carotene?
Beta-Carotene is a tetraterpene with 11 conjugated double bonds that give the molecule an orange color. It is insoluble in water but available in water-dispersible, oil-dispersible, and oil-soluble forms.
How is Beta-Carotene used in food products?
Beta-Carotene is used as a coloring agent in margarine, cheese, and pudding to produce the desired color. It is also used as an additive to provide a yellow-orange color.
What is the therapeutic function of Beta-Carotene?
Beta-Carotene is a Vitamin A precursor and acts as a sunscreen agent.
What are the side effects of Beta-Carotene?
Side effects of Beta-Carotene include skin discoloration, loose stools, bruising, and joint pain.
What are the sources of Beta-Carotene in the diet?
Beta-Carotene is abundantly present in yellow, orange, and green leafy fruits and vegetables such as carrots, spinach, lettuce, tomatoes, sweet potatoes, broccoli, cantaloupe, and winter squash.
How can Beta-Carotene be purified?
Beta-Carotene can be purified by crystallization, chromatography, or recrystallization from various solvents like C6H6/MeOH, pet ether, CS2/MeOH, Et2O/pet ether, acetone/pet ether, or toluene/MeOH.
If you have any questions, please contact us. You will get a satisfactory answer.
