Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0084 |
| Product Name | 2-Benzylheptanol |
| CAS | 92368-90-6 |
| Structure |  |
| Synonyms | 2-Benzyl-1-heptanol |
| IUPAC Name | 2-benzylheptan-1-ol |
| Molecular Weight | 206.32 g/mol |
| Molecular Formula | C14H22O |
| InChI | InChI=1S/C14H22O/c1-2-3-5-10-14(12-15)11-13-8-6-4-7-9-13/h4,6-9,14-15H,2-3,5,10-12H2,1H3 |
| InChI Key | CGMOOAUESLSUKM-UHFFFAOYSA-N |
| Boiling Point | 299.8 °C |
| Density | 0.94 g/mL |
| Appearance | Colorless, viscous liquid |
| Isomeric SMILES | CCCCCC(CC1=CC=CC=C1)CO |
If you have any questions, please contact us. You will get a satisfactory answer.
