Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-GU-0165 |
Product Name | Benzyl Salicylate |
CAS | 118-58-1 |
Structure | |
Synonyms | 2-Hydroxybenzoic acid, phenylmethyl ester;Salicylic acid, benzyl ester;FEMA No. 2151 |
IUPAC Name | benzyl 2-hydroxybenzoate |
Molecular Weight | 228.24 g/mol |
Molecular Formula | C14H12O3 |
InChI | InChI=1S/C14H12O3/c15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-9,15H,10H2 |
InChI Key | ZCTQGTTXIYCGGC-UHFFFAOYSA-N |
Boiling Point | 168-170 °C / 5mmHg |
Melting Point | 18-20 °C |
Purity | 95% |
Density | 1.17 g/mL |
Appearance | Solid |
Highest Usage In Residency Products | 0.0032 |
Highest Usage In Rinsing Products | 0.0037 |
Isomeric SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2O |
pKa | 8.11±0.30 |
What is the chemical formula for Benzyl Salicylate?
The chemical formula for Benzyl Salicylate is C14H12O3.
What is the melting point of Benzyl Salicylate?
The melting point of Benzyl Salicylate is 18-20 °C.
What is the boiling point of Benzyl Salicylate?
The boiling point of Benzyl Salicylate is 168-170 °C at 5 mm Hg.
How is Benzyl Salicylate described in terms of odor?
Benzyl Salicylate is described as having a pleasant odor, with a balsamic odor type.
What are some synonyms for Benzyl Salicylate?
Some synonyms for Benzyl Salicylate include benzyle salicylate and salicylic acid benzyl ester.
What are some of the uses of Benzyl Salicylate?
Benzyl Salicylate is commonly used in cosmetics, as a solvent for synthetic musks, and as a fixative in floral perfumes.
How is Benzyl Salicylate prepared?
Benzyl Salicylate is prepared by esterification of salicylic acid with benzyl alcohol.
What is the safety profile of Benzyl Salicylate?
Benzyl Salicylate is moderately toxic by ingestion, and can cause allergic reactions and contact dermatitis in sensitive individuals.
What are some plants where Benzyl Salicylate is naturally occurring?
Benzyl Salicylate is naturally occurring in carnations, primula auricula, American cranberry, clove bud, peppermint oil, and buckwheat.
How is Benzyl Salicylate classified in terms of hazard codes and risk statements?
Benzyl Salicylate is classified with hazard codes Xi and N, and with risk statements 36/37/38-51/53-43.