Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0096 |
| Product Name | Benzophenone-5 |
| CAS | 6628-37-1 |
| Structure |  |
| Synonyms | BP5, Sulisobenzone Sodium, 2-hydroxy 4-methoxy Benzophenone Sodium Sulfonate |
| IUPAC Name | sodium;5-benzoyl-4-hydroxy-2-methoxybenzenesulfonate |
| Molecular Weight | 332.3 g/mol |
| Molecular Formula | C14H13NaO6S |
| InChI | InChI=1S/C14H12O6S.Na/c1-20-12-8-11(15)10(7-13(12)21(17,18)19)14(16)9-5-3-2-4-6-9;/h2-8,15H,1H3,(H,17,18,19);/q;+1/p-1 |
| InChI Key | KJCLYACXIWMFCC-UHFFFAOYSA-M |
| Purity | 95% |
| Appearance | Solid |
| Isomeric SMILES | COC1=C(C=C(C(=C1)O)C(=O)C2=CC=CC=C2)S(=O)(=O)[O-].[Na+] |
What is the chemical name of benzophenone-5?
The chemical name of benzophenone-5 is 2-Hydroxy-4-methoxybenzophenone-5-sodium sulfonate.
What is another name for benzophenone-5?
Another name for benzophenone-5 is 5-(Benzoyl)-4-hydroxy-2-methoxybenzenesulfonic acid sodium salt.
What is the molecular formula of benzophenone-5?
The molecular formula of benzophenone-5 is C14H13NaO6S.
What is the molecular weight of benzophenone-5?
The molecular weight of benzophenone-5 is 332.3.
What is the CAS number of benzophenone-5?
The CAS number of benzophenone-5 is 6628-37-1.
What is the solubility of benzophenone-5 in DMSO, methanol, and water?
Benzophenone-5 is slightly soluble in DMSO, methanol, and water.
What is the color of benzophenone-5?
The color of benzophenone-5 is white to pale yellow.
What are the hazard codes associated with benzophenone-5?
The hazard code associated with benzophenone-5 is Xi.
What is the main usage of benzophenone-5?
Benzophenone-5 can be used for UV-blocking cosmetic composition.
How can benzophenone-5 be purified?
Benzophenone-5 can be purified by crystallizing it from MeOH and drying it under vacuum.
If you have any questions, please contact us. You will get a satisfactory answer.
