Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0170 |
| Product Name | Benzophenone-1 |
| CAS | 131-56-6 |
| Structure |  |
| Synonyms | 2,4-Dihydroxybenzophenone;Methanone, (2,4-dihydroxyphenyl)phenyl-;Benzophenone, 2,4-dihydroxy- |
| IUPAC Name | (2,4-dihydroxyphenyl)-phenylmethanone |
| Molecular Weight | 214.22 g/mol |
| Molecular Formula | C13H10O3 |
| InChI | InChI=1S/C13H10O3/c14-10-6-7-11(12(15)8-10)13(16)9-4-2-1-3-5-9/h1-8,14-15H |
| InChI Key | ZXDDPOHVAMWLBH-UHFFFAOYSA-N |
| Boiling Point | 194 °C / 1mmHg |
| Melting Point | 144.5-147 °C |
| Purity | 95% |
| Density | 1.32 g/mL |
| Solubility | insoluble |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0094 |
| Isomeric SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)O)O |
| pKa | 7.72±0.35 |
If you have any questions, please contact us. You will get a satisfactory answer.
