Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0169 |
| Product Name | Benzophenone-6 |
| CAS | 131-54-4 |
| Structure |  |
| Synonyms | 2,2'-Dihydroxy-4,4'-dimethoxybenzophenone |
| IUPAC Name | bis(2-hydroxy-4-methoxyphenyl)methanone |
| Molecular Weight | 274.27 g/mol |
| Molecular Formula | C15H14O5 |
| InChI | InChI=1S/C15H14O5/c1-19-9-3-5-11(13(16)7-9)15(18)12-6-4-10(20-2)8-14(12)17/h3-8,16-17H,1-2H3 |
| InChI Key | SODJJEXAWOSSON-UHFFFAOYSA-N |
| Boiling Point | 377.5 °C |
| Melting Point | 133-136 °C |
| Purity | 95% |
| Density | 1.27 g/mL |
| Appearance | Solid |
| Isomeric SMILES | COC1=CC(=C(C=C1)C(=O)C2=C(C=C(C=C2)OC)O)O |
| pKa | 6.81±0.35 |
If you have any questions, please contact us. You will get a satisfactory answer.
