Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0166 |
| Product Name | Benzophenone-8 |
| CAS | 131-53-3 |
| Structure |  |
| Synonyms | Dioxybenzone, 2,2'-Dihydroxy-4-methoxybenzophenone |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl)-(2-hydroxyphenyl)methanone |
| Molecular Weight | 244.24 g/mol |
| Molecular Formula | C14H12O4 |
| InChI | InChI=1S/C14H12O4/c1-18-9-6-7-11(13(16)8-9)14(17)10-4-2-3-5-12(10)15/h2-8,15-16H,1H3 |
| InChI Key | MEZZCSHVIGVWFI-UHFFFAOYSA-N |
| Boiling Point | 170-175 °C / 1mmHg |
| Melting Point | 73-75 °C |
| Purity | 95% |
| Density | 1.24 g/mL |
| Appearance | Solid |
| Isomeric SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2O)O |
| pKa | 7.11±0.35 |
If you have any questions, please contact us. You will get a satisfactory answer.
