Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0027 |
| Product Name | Azulene |
| CAS | 275-51-4 |
| Structure |  |
| Synonyms | Bicyclo(5.3.0)decapentaene |
| IUPAC Name | azulene |
| Molecular Weight | 128.17 g/mol |
| Molecular Formula | C10H8 |
| InChI | InChI=1S/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
| InChI Key | CUFNKYGDVFVPHO-UHFFFAOYSA-N |
| Boiling Point | 242 °C |
| Melting Point | 98-100 °C |
| Purity | 95% |
| Density | 1.05 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.01 |
| Highest Usage In Rinsing Products | 0.014 |
| Isomeric SMILES | C1=CC=C2C=CC=C2C=C1 |
What is the chemical formula of Azulene?
The chemical formula of Azulene is C10H8.
What is the melting point of Azulene?
The melting point of Azulene is 98-100 °C.
What color is Azulene?
Azulene is a dark blue fine crystalline powder.
Are there any safety hazards associated with Azulene?
Yes, Azulene is classified with hazard code N and risk statements 51/53.
In what temperature range should Azulene be stored?
Azulene should be stored at temperatures between +2°C to +8°C.
What is Azulene commonly used for?
Azulene is commonly used as an anti-inflammatory, calming, and soothing agent.
What type of compounds is Azulene soluble in?
Azulene is soluble in organic solvents.
How is Azulene synthesized?
Azulene is synthesized through a process of extraction from plants like German Chamomile.
What is the role of Azulene in cosmetics and skincare products?
Azulene is used as an active ingredient in cosmetics, shaving creams, and other topicals due to its antioxidant and anti-inflammatory properties.
Can Azulene form complexes with low valent metals?
Yes, Azulene can act as a ligand for low valent metals and form pi complexes with certain ligands in organometallic chemistry.
If you have any questions, please contact us. You will get a satisfactory answer.
