Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0074 |
| Product Name | Aspartame |
| CAS | 22839-47-0 |
| Structure |  |
| Synonyms | L-Phenylalanine, N-L-alpha-aspartyl-, 1-methyl ester;Methyl N-L-alpha-aspartyl-L-phenylalaninate |
| IUPAC Name | (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| Molecular Weight | 294.3 g/mol |
| Molecular Formula | C14H18N2O5 |
| InChI | InChI=1S/C14H18N2O5/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m0/s1 |
| InChI Key | IAOZJIPTCAWIRG-QWRGUYRKSA-N |
| Boiling Point | 436 °C |
| Melting Point | 242-248 °C |
| Purity | 95% |
| Density | 1.21 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0015 |
| Isomeric SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(=O)O)N |
If you have any questions, please contact us. You will get a satisfactory answer.
