Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1150 |
| Product Name | Arginine PCA |
| CAS | 56265-06-6 |
| Structure |  |
| Synonyms | 5-Oxo-L-proline, compound with L-arginine (1:1);Proline, 5-oxo-, L-, compd. with L-arginine (1:1) |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid |
| Molecular Weight | 303.32 g/mol |
| Molecular Formula | C11H21N5O5 |
| InChI | InChI=1S/C6H14N4O2.C5H7NO3/c7-4(5(11)12)2-1-3-10-6(8)9;7-4-2-1-3(6-4)5(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2H2,(H,6,7)(H,8,9)/t4-;3-/m00/s1 |
| InChI Key | UYCAGRPOUWSBIQ-WOYAITHZSA-N |
| Purity | 95% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0015 |
| Highest Usage In Rinsing Products | 0.0037 |
| Isomeric SMILES | C1CC(=O)N[C@@H]1C(=O)O.C(C[C@@H](C(=O)O)N)CN=C(N)N |
What is the chemical formula of L-Arginine-L-pyroglutamate?
The chemical formula of L-Arginine-L-pyroglutamate is C11H21N5O5.
What is the molecular weight of L-Arginine-L-pyroglutamate?
The molecular weight of L-Arginine-L-pyroglutamate is 303.31.
What are some synonyms for L-Arginine-L-pyroglutamate?
Some synonyms for L-Arginine-L-pyroglutamate are L-Arg-L-Pyr, ARGININE PCA, and L-ARGININE PYROGLUTAMIC ACID.
How should L-Arginine-L-pyroglutamate be stored?
L-Arginine-L-pyroglutamate should be stored under inert gas (nitrogen or Argon) at 2-8°C.
What is the logP value of L-Arginine-L-pyroglutamate?
The logP value of L-Arginine-L-pyroglutamate is -1.287 (estimated).
How is L-Arginine-L-pyroglutamate used in cosmetic preparations?
L-Arginine-L-pyroglutamate is used in cosmetic preparations to increase the skin's oxygen consumption and improve moisturization.
What category does L-Arginine-L-pyroglutamate fall under in terms of product categories?
L-Arginine-L-pyroglutamate falls under the categories of amino acid and nutritional supplements.
What is the CAS number for L-Arginine-L-pyroglutamate?
The CAS number for L-Arginine-L-pyroglutamate is 56265-06-6.
What is the EINECS number for L-Arginine-L-pyroglutamate?
The EINECS number for L-Arginine-L-pyroglutamate is 260-081-5.
What is the chemical structure of L-Arginine-L-pyroglutamate?
The chemical structure of L-Arginine-L-pyroglutamate is made up of L-arginine and 5-oxo-L-proline.
If you have any questions, please contact us. You will get a satisfactory answer.
