Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1302 |
| Product Name | Arginine HCl |
| CAS | 1119-34-2 |
| Structure |  |
| Synonyms | Arginine hydrochloride |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| Molecular Weight | 210.66 g/mol |
| Molecular Formula | C6H15ClN4O2 |
| InChI | InChI=1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m0./s1 |
| InChI Key | KWTQSFXGGICVPE-WCCKRBBISA-N |
| Melting Point | 226-230 °C |
| Purity | 95% |
| Density | 1.42 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.09 |
| Isomeric SMILES | C(C[C@@H](C(=O)O)N)CN=C(N)N.Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
