Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-FC-0067 |
Product Name | Arbutin |
CAS | 497-76-7 |
Structure | |
Synonyms | 4-Hydroxyphenyl-beta-d-glucopyranosid |
IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol |
Molecular Weight | 272.25 g/mol |
Molecular Formula | C12H16O7 |
InChI | InChI=1S/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
InChI Key | BJRNKVDFDLYUGJ-RMPHRYRLSA-N |
Boiling Point | 375.31 °C |
Melting Point | 195-198 °C |
Density | 1.36 g/mL |
Appearance | White solid |
Isomeric SMILES | C1=CC(=CC=C1O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
What is the chemical formula of arbutin?
The chemical formula of arbutin is C12H16O7.
What is the melting point of arbutin?
The melting point of arbutin is 195-198 °C.
How is arbutin used in skincare products?
Arbutin is used in whitening skincare products to reduce skin freckles, acne, hyperpigmentation, and age spots.
What precautions should be taken when using arbutin in skincare products?
Arbutin should be used in a pH range of 5 to 7 and with appropriate antioxidants for improved stability and efficacy.
What is the difference between Ursolic acid and α-arbutin?
Ursolic acid has various biological effects, while α-arbutin is a skin-repairing agent that can improve damaged skin transparency caused by UV radiation.
How does arbutin reduce melanin formation?
Arbutin inhibits the activity of tyrosinase, an enzyme that generates melanin.
What is the maximum safe concentration of arbutin in skincare products?
The maximum safe concentration of arbutin in skincare products is 7%.
What are the uses of arbutin?
Arbutin is used in diuretic and anti-infective drugs, color photographic stabilizers, whitening cosmetics, antibacterial products, and as a depigmentor.
How does arbutin work as a skin-lightening agent?
Arbutin acts as a tyrosinase inhibitor, preventing the formation of melanin and lightening the skin.
What are the safety aspects of arbutin in skincare products?
Arbutin has shown no toxicity, irritation, sensitization, or other side effects, making it safe for use in cosmetics.