Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-FC-0008 |
Product Name | Arachidyl glucoside |
CAS | 100231-68-3 |
Structure | |
Synonyms | Icosyl D-glucoside |
IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-icosoxyoxane-3,4,5-triol |
Molecular Weight | 460.69 g/mol |
Molecular Formula | C26H52O6 |
InChI | InChI=1S/C26H52O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-31-26-25(30)24(29)23(28)22(21-27)32-26/h22-30H,2-21H2,1H3/t22-,23-,24+,25-,26?/m1/s1 |
InChI Key | DHFUFHYLYSCIJY-XGHLBVCRSA-N |
Isomeric SMILES | CCCCCCCCCCCCCCCCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
What is the chemical formula for Arachidyl glucoside?
The chemical formula for Arachidyl glucoside is C26H52O6.
What is the molecular weight of Arachidyl glucoside?
The molecular weight of Arachidyl glucoside is 460.68748.
What is the common usage of Arachidyl glucoside?
Arachidyl glucoside is commonly used as an emulsifier in cosmetic creams or lotions to enhance their smoothness, creaminess, and thickness.
How does Arachidyl glucoside improve the quality of cosmetic creams or lotions?
Arachidyl glucoside enhances the quality of cosmetic creams or lotions by making them smoother, creamier, and thicker.
Can Arachidyl glucoside be used in other types of products besides cosmetics?
It is possible that Arachidyl glucoside may be used in other products for its emulsifying properties, but its most common application is in cosmetics.
Is Arachidyl glucoside a natural ingredient or a synthetic chemical?
Arachidyl glucoside is a chemical compound that is typically produced synthetically.
Are there any known side effects or sensitivities associated with the use of Arachidyl glucoside in cosmetics?
There are no widely reported side effects or sensitivities associated with the use of Arachidyl glucoside in cosmetics, but individuals with sensitive skin may want to perform a patch test before using products containing it.
How does Arachidyl glucoside function as an emulsifier in cosmetics?
Arachidyl glucoside helps to stabilize the mixture of water and oil-based ingredients in cosmetic formulations, preventing them from separating.
What are some alternatives to Arachidyl glucoside that can be used as emulsifiers in cosmetics?
Some alternative emulsifiers that can be used in cosmetics include cetearyl alcohol, glyceryl stearate, and sorbitan olivate.