Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0013 |
| Product Name | Aminopropanediol |
| CAS | 616-30-8 |
| Structure |  |
| Synonyms | 1-Aminopropanediol;1,2-Propanediol, 3-amino- |
| IUPAC Name | 3-aminopropane-1,2-diol |
| Molecular Weight | 91.11 g/mol |
| Molecular Formula | C3H9NO2 |
| InChI | InChI=1S/C3H9NO2/c4-1-3(6)2-5/h3,5-6H,1-2,4H2 |
| InChI Key | KQIGMPWTAHJUMN-UHFFFAOYSA-N |
| Boiling Point | 264-265 °C / 739mmHg |
| Melting Point | 55-57 °C |
| Purity | 95% |
| Density | 1.18 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.0007 |
| Isomeric SMILES | C(C(CO)O)N |
| pKa | 12.11±0.35 |
If you have any questions, please contact us. You will get a satisfactory answer.
