Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0299 |
| Product Name | 4-Amino-3-Nitrophenol |
| CAS | 610-81-1 |
| Structure |  |
| Synonyms | 2-Amino-5-hydroxynitrobenzene |
| IUPAC Name | 4-amino-3-nitrophenol |
| Molecular Weight | 154.12 g/mol |
| Molecular Formula | C6H6N2O3 |
| InChI | InChI=1S/C6H6N2O3/c7-5-2-1-4(9)3-6(5)8(10)11/h1-3,9H,7H2 |
| InChI Key | IQXUIDYRTHQTET-UHFFFAOYSA-N |
| Boiling Point | 322.5 °C |
| Melting Point | 150-154 °C |
| Purity | 0.98 |
| Density | 1.36 g/mL |
| Appearance | Powder |
| Isomeric SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])N |
| pKa | 9.21±0.10 |
What is the chemical name of the compound with the CAS number 610-81-1?
The chemical name is 4-Amino-3-nitrophenol.
What are some synonyms for 4-Amino-3-nitrophenol?
Some synonyms include JAROCOL 4A3NP, 4-Hydroxy-2-nitroaniline, and 2-Amino-5-hydroxynitrobenzene among others.
What is the molecular formula of 4-Amino-3-nitrophenol?
The molecular formula is C6H6N2O3.
What is the melting point of 4-Amino-3-nitrophenol?
The melting point is 150-154 °C.
In what color does 4-Amino-3-nitrophenol exist in?
The compound exists in a deep violet color.
What is the usage of 4-Amino-3-nitrophenol?
It is used in hair dyes, potent human skin sensitizers, and other cosmetic products with low mutagenic activity.
How is 4-Amino-3-nitrophenol stored?
It is stored in a dark place, under an inert atmosphere, at room temperature.
What is the water solubility of 4-Amino-3-nitrophenol?
It is soluble in water.
What are the hazard codes associated with 4-Amino-3-nitrophenol?
The hazard codes are Xi and Xn.
If you have any questions, please contact us. You will get a satisfactory answer.
