Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0280 |
| Product Name | 6-Amino-m-Cresol |
| CAS | 2835-98-5 |
| Structure |  |
| Synonyms | 2-Amino-5-methylphenol |
| IUPAC Name | 2-amino-5-methylphenol |
| Molecular Weight | 123.15 g/mol |
| Molecular Formula | C7H9NO |
| InChI | InChI=1S/C7H9NO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,8H2,1H3 |
| InChI Key | HCPJEHJGFKWRFM-UHFFFAOYSA-N |
| Boiling Point | 229 °C |
| Melting Point | 160-162 °C |
| Purity | 0.98 |
| Density | 1.09 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=CC(=C(C=C1)N)O |
| pKa | 9.87±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
