Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0259 |
| Product Name | 2-Amino-4-Hydroxyethylaminoanisole |
| CAS | 83763-47-7 |
| Structure |  |
| Synonyms | 2-[(3-amino-4-methoxyphenyl)amino]ethanol |
| IUPAC Name | 2-(3-amino-4-methoxyanilino)ethanol |
| Molecular Weight | 182.22 g/mol |
| Molecular Formula | C9H14N2O2 |
| InChI | InChI=1S/C9H14N2O2/c1-13-9-3-2-7(6-8(9)10)11-4-5-12/h2-3,6,11-12H,4-5,10H2,1H3 |
| InChI Key | SBUMIGFDXJIPLE-UHFFFAOYSA-N |
| Boiling Point | 401.8±40.0 °C |
| Purity | 0.95 |
| Isomeric SMILES | COC1=C(C=C(C=C1)NCCO)N |
If you have any questions, please contact us. You will get a satisfactory answer.
