Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0027 |
| Product Name | 5-Amino-6-Chloro-o-Cresol |
| CAS | 84540-50-1 |
| Structure |  |
| Synonyms | 3-Amino-2-chlor-6-methylphenol |
| IUPAC Name | 3-amino-2-chloro-6-methylphenol |
| Molecular Weight | 157.6 g/mol |
| Molecular Formula | C7H8ClNO |
| InChI | InChI=1S/C7H8ClNO/c1-4-2-3-5(9)6(8)7(4)10/h2-3,10H,9H2,1H3 |
| InChI Key | XYRDGCCCBJITBH-UHFFFAOYSA-N |
| Boiling Point | 262.7±35.0 °C |
| Melting Point | 80-83 °C |
| Purity | 0.98 |
| Density | 1.331 g/mL |
| Appearance | Powder |
| Isomeric SMILES | CC1=C(C(=C(C=C1)N)Cl)O |
| pKa | 8.89±0.15 |
If you have any questions, please contact us. You will get a satisfactory answer.
